C23H17BrN6OS — CID 86623952
6-[4-(azidomethyl)-1,3-thiazol-2-yl]-3-(4-bromophenyl)-1,9-dimethylpyrido[2,3-b]indol-2-one (PubChem CID 86623952) has the molecular formula C23H17BrN6OS and a molecular weight of 505.40 g/mol. Its IUPAC name is 6-[4-(azidomethyl)-1,3-thiazol-2-yl]-3-(4-bromophenyl)-1,9-dimethylpyrido[2,3-b]indol-2-one.
| Compound Name | 6-[4-(azidomethyl)-1,3-thiazol-2-yl]-3-(4-bromophenyl)-1,9-dimethylpyrido[2,3-b]indol-2-one |
|---|---|
| PubChem CID | 86623952 |
| Molecular Formula | C23H17BrN6OS |
| Molecular Weight | 505.40 g/mol |
| Exact Mass | 504.04 |
| IUPAC Name | 6-[4-(azidomethyl)-1,3-thiazol-2-yl]-3-(4-bromophenyl)-1,9-dimethylpyrido[2,3-b]indol-2-one |
| SMILES | Cn1c(=O)c(-c2ccc(Br)cc2)cc2c3cc(-c4nc(CN=[N+]=[N-])cs4)ccc3n(C)c21 |
| InChI | InChI=1S/C23H17BrN6OS/c1-29-20-8-5-14(21-27-16(12-32-21)11-26-28-25)9-18(20)19-10-17(23(31)30(2)22(19)29)13-3-6-15(24)7-4-13/h3-10,12H,11H2,1-2H3 |
| InChIKey | OPZUOYKLFLBASW-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 88.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.40 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|