C18H19N5OS2 — CID 86624078
3H-benzimidazol-5-ylmethanamine;2-sulfanylidene-5,6,7,8-tetrahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 86624078) has the molecular formula C18H19N5OS2 and a molecular weight of 385.52 g/mol. Its IUPAC name is 3H-benzimidazol-5-ylmethanamine;2-sulfanylidene-5,6,7,8-tetrahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | 3H-benzimidazol-5-ylmethanamine;2-sulfanylidene-5,6,7,8-tetrahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 86624078 |
| Molecular Formula | C18H19N5OS2 |
| Molecular Weight | 385.52 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | 3H-benzimidazol-5-ylmethanamine;2-sulfanylidene-5,6,7,8-tetrahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | NCc1ccc2nc[nH]c2c1.O=c1[nH]c(=S)[nH]c2sc3c(c12)CCCC3 |
| InChI | InChI=1S/C10H10N2OS2.C8H9N3/c13-8-7-5-3-1-2-4-6(5)15-9(7)12-10(14)11-8;9-4-6-1-2-7-8(3-6)11-5-10-7/h1-4H2,(H2,11,12,13,14);1-3,5H,4,9H2,(H,10,11) |
| InChIKey | LJQWJXOMYAOSIB-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 103.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.52 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|