C8H12F2O2 — CID 86624087
4-butoxy-1,1-difluorobut-3-en-2-one (PubChem CID 86624087) has the molecular formula C8H12F2O2 and a molecular weight of 178.18 g/mol. Its IUPAC name is 4-butoxy-1,1-difluorobut-3-en-2-one.
| Compound Name | 4-butoxy-1,1-difluorobut-3-en-2-one |
|---|---|
| PubChem CID | 86624087 |
| Molecular Formula | C8H12F2O2 |
| Molecular Weight | 178.18 g/mol |
| Exact Mass | 178.08 |
| IUPAC Name | 4-butoxy-1,1-difluorobut-3-en-2-one |
| SMILES | CCCCOC=CC(=O)C(F)F |
| InChI | InChI=1S/C8H12F2O2/c1-2-3-5-12-6-4-7(11)8(9)10/h4,6,8H,2-3,5H2,1H3 |
| InChIKey | RGRPONOJAUJNSR-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.18 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|