C9H3ClF7NO3 — CID 86624092
5-chloro-6-(1,1,2,2,3,3,3-heptafluoropropyl)-2-oxo-1H-pyridine-3-carboxylic acid (PubChem CID 86624092) has the molecular formula C9H3ClF7NO3 and a molecular weight of 341.57 g/mol. Its IUPAC name is 5-chloro-6-(1,1,2,2,3,3,3-heptafluoropropyl)-2-oxo-1H-pyridine-3-carboxylic acid.
| Compound Name | 5-chloro-6-(1,1,2,2,3,3,3-heptafluoropropyl)-2-oxo-1H-pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 86624092 |
| Molecular Formula | C9H3ClF7NO3 |
| Molecular Weight | 341.57 g/mol |
| Exact Mass | 340.97 |
| IUPAC Name | 5-chloro-6-(1,1,2,2,3,3,3-heptafluoropropyl)-2-oxo-1H-pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1cc(Cl)c(C(F)(F)C(F)(F)C(F)(F)F)[nH]c1=O |
| InChI | InChI=1S/C9H3ClF7NO3/c10-3-1-2(6(20)21)5(19)18-4(3)7(11,12)8(13,14)9(15,16)17/h1H,(H,18,19)(H,20,21) |
| InChIKey | VQNYOSFPSHHNEB-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 70.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.57 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|