C26H47N3O2Si2 — CID 86624120
4-N-[(2R)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]-3-methylbutan-2-yl]quinoline-3,4-diamine (PubChem CID 86624120) has the molecular formula C26H47N3O2Si2 and a molecular weight of 489.85 g/mol. Its IUPAC name is 4-N-[(2R)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]-3-methylbutan-2-yl]quinoline-3,4-diamine.
| Compound Name | 4-N-[(2R)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]-3-methylbutan-2-yl]quinoline-3,4-diamine |
|---|---|
| PubChem CID | 86624120 |
| Molecular Formula | C26H47N3O2Si2 |
| Molecular Weight | 489.85 g/mol |
| Exact Mass | 489.32 |
| IUPAC Name | 4-N-[(2R)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]-3-methylbutan-2-yl]quinoline-3,4-diamine |
| SMILES | CC(C)(O[Si](C)(C)C(C)(C)C)[C@@H](CO[Si](C)(C)C(C)(C)C)Nc1c(N)cnc2ccccc12 |
| InChI | InChI=1S/C26H47N3O2Si2/c1-24(2,3)32(9,10)30-18-22(26(7,8)31-33(11,12)25(4,5)6)29-23-19-15-13-14-16-21(19)28-17-20(23)27/h13-17,22H,18,27H2,1-12H3,(H,28,29)/t22-/m1/s1 |
| InChIKey | OINQBSLQFQSSJK-JOCHJYFZSA-N |
| XLogP | 7.42 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.85 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|