C25H18FN9OS2 — CID 86624336
2-amino-4-[4-(2-azidoethoxy)phenyl]-6-[[2-(4-fluoroanilino)-1,3-thiazol-4-yl]methylsulfanyl]pyridine-3,5-dicarbonitrile (PubChem CID 86624336) has the molecular formula C25H18FN9OS2 and a molecular weight of 543.61 g/mol. Its IUPAC name is 2-amino-4-[4-(2-azidoethoxy)phenyl]-6-[[2-(4-fluoroanilino)-1,3-thiazol-4-yl]methylsulfanyl]pyridine-3,5-dicarbonitrile.
| Compound Name | 2-amino-4-[4-(2-azidoethoxy)phenyl]-6-[[2-(4-fluoroanilino)-1,3-thiazol-4-yl]methylsulfanyl]pyridine-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 86624336 |
| Molecular Formula | C25H18FN9OS2 |
| Molecular Weight | 543.61 g/mol |
| Exact Mass | 543.11 |
| IUPAC Name | 2-amino-4-[4-(2-azidoethoxy)phenyl]-6-[[2-(4-fluoroanilino)-1,3-thiazol-4-yl]methylsulfanyl]pyridine-3,5-dicarbonitrile |
| SMILES | N#Cc1c(N)nc(SCc2csc(Nc3ccc(F)cc3)n2)c(C#N)c1-c1ccc(OCCN=[N+]=[N-])cc1 |
| InChI | InChI=1S/C25H18FN9OS2/c26-16-3-5-17(6-4-16)32-25-33-18(14-38-25)13-37-24-21(12-28)22(20(11-27)23(29)34-24)15-1-7-19(8-2-15)36-10-9-31-35-30/h1-8,14H,9-10,13H2,(H2,29,34)(H,32,33) |
| InChIKey | YFFIKGNNBQWXHD-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 169.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.61 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|