C20H21ClF6N8O4 — CID 86624992
5-chloro-3-(morpholin-4-ylmethyl)-N-pyrimidin-4-yl-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazolo[4,5-d]pyrimidin-7-amine;2,2,2-trifluoroacetic acid (PubChem CID 86624992) has the molecular formula C20H21ClF6N8O4 and a molecular weight of 586.88 g/mol. Its IUPAC name is 5-chloro-3-(morpholin-4-ylmethyl)-N-pyrimidin-4-yl-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazolo[4,5-d]pyrimidin-7-amine;2,2,2-trifluoroacetic acid.
| Compound Name | 5-chloro-3-(morpholin-4-ylmethyl)-N-pyrimidin-4-yl-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazolo[4,5-d]pyrimidin-7-amine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 86624992 |
| Molecular Formula | C20H21ClF6N8O4 |
| Molecular Weight | 586.88 g/mol |
| Exact Mass | 586.13 |
| IUPAC Name | 5-chloro-3-(morpholin-4-ylmethyl)-N-pyrimidin-4-yl-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazolo[4,5-d]pyrimidin-7-amine;2,2,2-trifluoroacetic acid |
| SMILES | FC(F)(F)COCCn1nc(CN2CCOCC2)c2nc(Cl)nc(Nc3ccncn3)c21.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H20ClF3N8O2.C2HF3O2/c19-17-26-14-12(9-29-3-6-31-7-4-29)28-30(5-8-32-10-18(20,21)22)15(14)16(27-17)25-13-1-2-23-11-24-13;3-2(4,5)1(6)7/h1-2,11H,3-10H2,(H,23,24,25,26,27);(H,6,7) |
| InChIKey | CLSHNVHRCDWNOJ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 140.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.88 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|