C30H29N9O2 — CID 86625280
7-(6-azidopyrimidin-4-yl)oxy-N-[3-tert-butyl-1-(4-propan-2-ylphenyl)pyrazol-5-yl]isoquinoline-4-carboxamide (PubChem CID 86625280) has the molecular formula C30H29N9O2 and a molecular weight of 547.62 g/mol. Its IUPAC name is 7-(6-azidopyrimidin-4-yl)oxy-N-[3-tert-butyl-1-(4-propan-2-ylphenyl)pyrazol-5-yl]isoquinoline-4-carboxamide.
| Compound Name | 7-(6-azidopyrimidin-4-yl)oxy-N-[3-tert-butyl-1-(4-propan-2-ylphenyl)pyrazol-5-yl]isoquinoline-4-carboxamide |
|---|---|
| PubChem CID | 86625280 |
| Molecular Formula | C30H29N9O2 |
| Molecular Weight | 547.62 g/mol |
| Exact Mass | 547.24 |
| IUPAC Name | 7-(6-azidopyrimidin-4-yl)oxy-N-[3-tert-butyl-1-(4-propan-2-ylphenyl)pyrazol-5-yl]isoquinoline-4-carboxamide |
| SMILES | CC(C)c1ccc(-n2nc(C(C)(C)C)cc2NC(=O)c2cncc3cc(Oc4cc(N=[N+]=[N-])ncn4)ccc23)cc1 |
| InChI | InChI=1S/C30H29N9O2/c1-18(2)19-6-8-21(9-7-19)39-27(13-25(37-39)30(3,4)5)35-29(40)24-16-32-15-20-12-22(10-11-23(20)24)41-28-14-26(36-38-31)33-17-34-28/h6-18H,1-5H3,(H,35,40) |
| InChIKey | ICCVSKJESBOTNB-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 143.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.62 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|