About 4-(6-bromo-1-benzothiophen-2-yl)-2,5-dichloropyrimidine
4-(6-bromo-1-benzothiophen-2-yl)-2,5-dichloropyrimidine (PubChem CID 86625387) has the molecular formula C12H5BrCl2N2S
and a molecular weight of 360.06 g/mol. Its IUPAC name is 4-(6-bromo-1-benzothiophen-2-yl)-2,5-dichloropyrimidine.
Molecular Properties
| Compound Name | 4-(6-bromo-1-benzothiophen-2-yl)-2,5-dichloropyrimidine |
| PubChem CID | 86625387 |
| Molecular Formula | C12H5BrCl2N2S |
| Molecular Weight | 360.06 g/mol |
| Exact Mass | 357.87 |
| IUPAC Name | 4-(6-bromo-1-benzothiophen-2-yl)-2,5-dichloropyrimidine |
| SMILES | Clc1ncc(Cl)c(-c2cc3ccc(Br)cc3s2)n1 |
| InChI | InChI=1S/C12H5BrCl2N2S/c13-7-2-1-6-3-10(18-9(6)4-7)11-8(14)5-16-12(15)17-11/h1-5H |
| InChIKey | ZELCMVLXDKQJJM-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 360.06 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(6-bromo-1-benzothiophen-2-yl)-2,5-dichloropyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(6-bromo-1-benzothiophen-2-yl)-2,5-dichloropyrimidine?
The IUPAC name of 4-(6-bromo-1-benzothiophen-2-yl)-2,5-dichloropyrimidine (CID 86625387) is 4-(6-bromo-1-benzothiophen-2-yl)-2,5-dichloropyrimidine.
What is the SMILES notation for 4-(6-bromo-1-benzothiophen-2-yl)-2,5-dichloropyrimidine?
The canonical SMILES for 4-(6-bromo-1-benzothiophen-2-yl)-2,5-dichloropyrimidine is Clc1ncc(Cl)c(-c2cc3ccc(Br)cc3s2)n1.
What is the InChIKey of 4-(6-bromo-1-benzothiophen-2-yl)-2,5-dichloropyrimidine?
The InChIKey is ZELCMVLXDKQJJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H5BrCl2N2S/c13-7-2-1-6-3-10(18-9(6)4-7)11-8(14)5-16-12(15)17-11/h1-5H.
What are the key properties of 4-(6-bromo-1-benzothiophen-2-yl)-2,5-dichloropyrimidine?
4-(6-bromo-1-benzothiophen-2-yl)-2,5-dichloropyrimidine has a molecular weight of 360.06 g/mol, XLogP of 5.43, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(6-bromo-1-benzothiophen-2-yl)-2,5-dichloropyrimidine is sourced from PubChem (CID 86625387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).