C8H15F3N2O3 — CID 86625698
(2S)-2-amino-N,N-dimethylbutanamide;2,2,2-trifluoroacetic acid (PubChem CID 86625698) has the molecular formula C8H15F3N2O3 and a molecular weight of 244.21 g/mol. Its IUPAC name is (2S)-2-amino-N,N-dimethylbutanamide;2,2,2-trifluoroacetic acid.
| Compound Name | (2S)-2-amino-N,N-dimethylbutanamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 86625698 |
| Molecular Formula | C8H15F3N2O3 |
| Molecular Weight | 244.21 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | (2S)-2-amino-N,N-dimethylbutanamide;2,2,2-trifluoroacetic acid |
| SMILES | CC[C@H](N)C(=O)N(C)C.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C6H14N2O.C2HF3O2/c1-4-5(7)6(9)8(2)3;3-2(4,5)1(6)7/h5H,4,7H2,1-3H3;(H,6,7)/t5-;/m0./s1 |
| InChIKey | IRYOFKVRCUAIEK-JEDNCBNOSA-N |
| XLogP | 0.45 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.21 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |