2-amino-N,N,2-trimethylpropanamide;2,2,2-trifluoroacetic acid

C8H15F3N2O3 — CID 86625724

IUPAC2-amino-N,N,2-trimethylpropanamide;2,2,2-trifluoroacetic acid
SMILESCN(C)C(=O)C(C)(C)N.O=C(O)C(F)(F)F
InChIInChI=1S/C6H14N2O.C2HF3O2/c1-6(2,7)5(9)8(3)4;3-2(4,5)1(6)7/h7H2,1-4H3;(H,6,7)
InChIKeyCWIBNJHFEBNAIH-UHFFFAOYSA-N
MW244.21 g/mol
LogP0.45
Rot. Bonds1

About 2-amino-N,N,2-trimethylpropanamide;2,2,2-trifluoroacetic acid

2-amino-N,N,2-trimethylpropanamide;2,2,2-trifluoroacetic acid (PubChem CID 86625724) has the molecular formula C8H15F3N2O3 and a molecular weight of 244.21 g/mol. Its IUPAC name is 2-amino-N,N,2-trimethylpropanamide;2,2,2-trifluoroacetic acid.

Molecular Properties

Compound Name2-amino-N,N,2-trimethylpropanamide;2,2,2-trifluoroacetic acid
PubChem CID86625724
Molecular FormulaC8H15F3N2O3
Molecular Weight244.21 g/mol
Exact Mass244.10
IUPAC Name2-amino-N,N,2-trimethylpropanamide;2,2,2-trifluoroacetic acid
SMILESCN(C)C(=O)C(C)(C)N.O=C(O)C(F)(F)F
InChIInChI=1S/C6H14N2O.C2HF3O2/c1-6(2,7)5(9)8(3)4;3-2(4,5)1(6)7/h7H2,1-4H3;(H,6,7)
InChIKeyCWIBNJHFEBNAIH-UHFFFAOYSA-N
XLogP0.45
TPSA83.63 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500244.21
LogP ≤ 50.45
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 2-amino-N,N,2-trimethylpropanamide;2,2,2-trifluoroacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-amino-N,N,2-trimethylpropanamide;2,2,2-trifluoroacetic acid?
The IUPAC name of 2-amino-N,N,2-trimethylpropanamide;2,2,2-trifluoroacetic acid (CID 86625724) is 2-amino-N,N,2-trimethylpropanamide;2,2,2-trifluoroacetic acid.
What is the SMILES notation for 2-amino-N,N,2-trimethylpropanamide;2,2,2-trifluoroacetic acid?
The canonical SMILES for 2-amino-N,N,2-trimethylpropanamide;2,2,2-trifluoroacetic acid is CN(C)C(=O)C(C)(C)N.O=C(O)C(F)(F)F.
What is the InChIKey of 2-amino-N,N,2-trimethylpropanamide;2,2,2-trifluoroacetic acid?
The InChIKey is CWIBNJHFEBNAIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14N2O.C2HF3O2/c1-6(2,7)5(9)8(3)4;3-2(4,5)1(6)7/h7H2,1-4H3;(H,6,7).
What are the key properties of 2-amino-N,N,2-trimethylpropanamide;2,2,2-trifluoroacetic acid?
2-amino-N,N,2-trimethylpropanamide;2,2,2-trifluoroacetic acid has a molecular weight of 244.21 g/mol, XLogP of 0.45, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-N,N,2-trimethylpropanamide;2,2,2-trifluoroacetic acid is sourced from PubChem (CID 86625724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).