About 4-bromo-3H-imidazo[4,5-c]quinoline
4-bromo-3H-imidazo[4,5-c]quinoline (PubChem CID 86625982) has the molecular formula C10H6BrN3
and a molecular weight of 248.08 g/mol. Its IUPAC name is 4-bromo-3H-imidazo[4,5-c]quinoline.
Molecular Properties
| Compound Name | 4-bromo-3H-imidazo[4,5-c]quinoline |
| PubChem CID | 86625982 |
| Molecular Formula | C10H6BrN3 |
| Molecular Weight | 248.08 g/mol |
| Exact Mass | 246.97 |
| IUPAC Name | 4-bromo-3H-imidazo[4,5-c]quinoline |
| SMILES | Brc1nc2ccccc2c2nc[nH]c12 |
| InChI | InChI=1S/C10H6BrN3/c11-10-9-8(12-5-13-9)6-3-1-2-4-7(6)14-10/h1-5H,(H,12,13) |
| InChIKey | ZATMOGBXZTYQAG-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.08 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-3H-imidazo[4,5-c]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-3H-imidazo[4,5-c]quinoline?
The IUPAC name of 4-bromo-3H-imidazo[4,5-c]quinoline (CID 86625982) is 4-bromo-3H-imidazo[4,5-c]quinoline.
What is the SMILES notation for 4-bromo-3H-imidazo[4,5-c]quinoline?
The canonical SMILES for 4-bromo-3H-imidazo[4,5-c]quinoline is Brc1nc2ccccc2c2nc[nH]c12.
What is the InChIKey of 4-bromo-3H-imidazo[4,5-c]quinoline?
The InChIKey is ZATMOGBXZTYQAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6BrN3/c11-10-9-8(12-5-13-9)6-3-1-2-4-7(6)14-10/h1-5H,(H,12,13).
What are the key properties of 4-bromo-3H-imidazo[4,5-c]quinoline?
4-bromo-3H-imidazo[4,5-c]quinoline has a molecular weight of 248.08 g/mol, XLogP of 2.87, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-3H-imidazo[4,5-c]quinoline is sourced from PubChem (CID 86625982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).