About 4-bromo-2-(methoxymethyl)-1-(2-methylpropyl)imidazo[4,5-c]quinolin-8-ol
4-bromo-2-(methoxymethyl)-1-(2-methylpropyl)imidazo[4,5-c]quinolin-8-ol (PubChem CID 86626170) has the molecular formula C16H18BrN3O2
and a molecular weight of 364.24 g/mol. Its IUPAC name is 4-bromo-2-(methoxymethyl)-1-(2-methylpropyl)imidazo[4,5-c]quinolin-8-ol.
Molecular Properties
| Compound Name | 4-bromo-2-(methoxymethyl)-1-(2-methylpropyl)imidazo[4,5-c]quinolin-8-ol |
| PubChem CID | 86626170 |
| Molecular Formula | C16H18BrN3O2 |
| Molecular Weight | 364.24 g/mol |
| Exact Mass | 363.06 |
| IUPAC Name | 4-bromo-2-(methoxymethyl)-1-(2-methylpropyl)imidazo[4,5-c]quinolin-8-ol |
| SMILES | COCc1nc2c(Br)nc3ccc(O)cc3c2n1CC(C)C |
| InChI | InChI=1S/C16H18BrN3O2/c1-9(2)7-20-13(8-22-3)19-14-15(20)11-6-10(21)4-5-12(11)18-16(14)17/h4-6,9,21H,7-8H2,1-3H3 |
| InChIKey | GPUMFBOFSCSQCL-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.24 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-2-(methoxymethyl)-1-(2-methylpropyl)imidazo[4,5-c]quinolin-8-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-2-(methoxymethyl)-1-(2-methylpropyl)imidazo[4,5-c]quinolin-8-ol?
The IUPAC name of 4-bromo-2-(methoxymethyl)-1-(2-methylpropyl)imidazo[4,5-c]quinolin-8-ol (CID 86626170) is 4-bromo-2-(methoxymethyl)-1-(2-methylpropyl)imidazo[4,5-c]quinolin-8-ol.
What is the SMILES notation for 4-bromo-2-(methoxymethyl)-1-(2-methylpropyl)imidazo[4,5-c]quinolin-8-ol?
The canonical SMILES for 4-bromo-2-(methoxymethyl)-1-(2-methylpropyl)imidazo[4,5-c]quinolin-8-ol is COCc1nc2c(Br)nc3ccc(O)cc3c2n1CC(C)C.
What is the InChIKey of 4-bromo-2-(methoxymethyl)-1-(2-methylpropyl)imidazo[4,5-c]quinolin-8-ol?
The InChIKey is GPUMFBOFSCSQCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18BrN3O2/c1-9(2)7-20-13(8-22-3)19-14-15(20)11-6-10(21)4-5-12(11)18-16(14)17/h4-6,9,21H,7-8H2,1-3H3.
What are the key properties of 4-bromo-2-(methoxymethyl)-1-(2-methylpropyl)imidazo[4,5-c]quinolin-8-ol?
4-bromo-2-(methoxymethyl)-1-(2-methylpropyl)imidazo[4,5-c]quinolin-8-ol has a molecular weight of 364.24 g/mol, XLogP of 3.86, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-2-(methoxymethyl)-1-(2-methylpropyl)imidazo[4,5-c]quinolin-8-ol is sourced from PubChem (CID 86626170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).