About 2-chloro-N'-(2-hydroxyethyl)ethanimidamide;hydrochloride
2-chloro-N'-(2-hydroxyethyl)ethanimidamide;hydrochloride (PubChem CID 86626230) has the molecular formula C4H10Cl2N2O
and a molecular weight of 173.04 g/mol. Its IUPAC name is 2-chloro-N'-(2-hydroxyethyl)ethanimidamide;hydrochloride.
Molecular Properties
| Compound Name | 2-chloro-N'-(2-hydroxyethyl)ethanimidamide;hydrochloride |
| PubChem CID | 86626230 |
| Molecular Formula | C4H10Cl2N2O |
| Molecular Weight | 173.04 g/mol |
| Exact Mass | 172.02 |
| IUPAC Name | 2-chloro-N'-(2-hydroxyethyl)ethanimidamide;hydrochloride |
| SMILES | Cl.N/C(CCl)=N/CCO |
| InChI | InChI=1S/C4H9ClN2O.ClH/c5-3-4(6)7-1-2-8;/h8H,1-3H2,(H2,6,7);1H |
| InChIKey | RMZJNYRGRNIECT-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 58.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.04 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-N'-(2-hydroxyethyl)ethanimidamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N'-(2-hydroxyethyl)ethanimidamide;hydrochloride?
The IUPAC name of 2-chloro-N'-(2-hydroxyethyl)ethanimidamide;hydrochloride (CID 86626230) is 2-chloro-N'-(2-hydroxyethyl)ethanimidamide;hydrochloride.
What is the SMILES notation for 2-chloro-N'-(2-hydroxyethyl)ethanimidamide;hydrochloride?
The canonical SMILES for 2-chloro-N'-(2-hydroxyethyl)ethanimidamide;hydrochloride is Cl.N/C(CCl)=N/CCO.
What is the InChIKey of 2-chloro-N'-(2-hydroxyethyl)ethanimidamide;hydrochloride?
The InChIKey is RMZJNYRGRNIECT-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9ClN2O.ClH/c5-3-4(6)7-1-2-8;/h8H,1-3H2,(H2,6,7);1H.
What are the key properties of 2-chloro-N'-(2-hydroxyethyl)ethanimidamide;hydrochloride?
2-chloro-N'-(2-hydroxyethyl)ethanimidamide;hydrochloride has a molecular weight of 173.04 g/mol, XLogP of -0.00, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N'-(2-hydroxyethyl)ethanimidamide;hydrochloride is sourced from PubChem (CID 86626230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).