C24H35N3O — CID 86626952
1-N,1-N-dibutyl-7-N,7-N-diethyl-10H-phenoxazine-1,7-diamine (PubChem CID 86626952) has the molecular formula C24H35N3O and a molecular weight of 381.56 g/mol. Its IUPAC name is 1-N,1-N-dibutyl-7-N,7-N-diethyl-10H-phenoxazine-1,7-diamine.
| Compound Name | 1-N,1-N-dibutyl-7-N,7-N-diethyl-10H-phenoxazine-1,7-diamine |
|---|---|
| PubChem CID | 86626952 |
| Molecular Formula | C24H35N3O |
| Molecular Weight | 381.56 g/mol |
| Exact Mass | 381.28 |
| IUPAC Name | 1-N,1-N-dibutyl-7-N,7-N-diethyl-10H-phenoxazine-1,7-diamine |
| SMILES | CCCCN(CCCC)c1cccc2c1Nc1ccc(N(CC)CC)cc1O2 |
| InChI | InChI=1S/C24H35N3O/c1-5-9-16-27(17-10-6-2)21-12-11-13-22-24(21)25-20-15-14-19(18-23(20)28-22)26(7-3)8-4/h11-15,18,25H,5-10,16-17H2,1-4H3 |
| InChIKey | LLVMMSZEBKRTBT-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.56 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |