C20H16F3N3O3 — CID 86627347
3-nitro-2-[4-[3-[3-(trifluoromethoxy)phenyl]prop-2-ynylidene]piperidin-1-yl]pyridine (PubChem CID 86627347) has the molecular formula C20H16F3N3O3 and a molecular weight of 403.36 g/mol. Its IUPAC name is 3-nitro-2-[4-[3-[3-(trifluoromethoxy)phenyl]prop-2-ynylidene]piperidin-1-yl]pyridine.
| Compound Name | 3-nitro-2-[4-[3-[3-(trifluoromethoxy)phenyl]prop-2-ynylidene]piperidin-1-yl]pyridine |
|---|---|
| PubChem CID | 86627347 |
| Molecular Formula | C20H16F3N3O3 |
| Molecular Weight | 403.36 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | 3-nitro-2-[4-[3-[3-(trifluoromethoxy)phenyl]prop-2-ynylidene]piperidin-1-yl]pyridine |
| SMILES | O=[N+]([O-])c1cccnc1N1CCC(=CC#Cc2cccc(OC(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C20H16F3N3O3/c21-20(22,23)29-17-7-2-6-16(14-17)5-1-4-15-9-12-25(13-10-15)19-18(26(27)28)8-3-11-24-19/h2-4,6-8,11,14H,9-10,12-13H2 |
| InChIKey | PIRFRBWOCLKSIW-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 68.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.36 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|