About CID 86627681
CID 86627681 (PubChem CID 86627681) has the molecular formula C7H16F3O3SSi
and a molecular weight of 265.35 g/mol.
Molecular Properties
| Compound Name | CID 86627681 |
| PubChem CID | 86627681 |
| Molecular Formula | C7H16F3O3SSi |
| Molecular Weight | 265.35 g/mol |
| Exact Mass | 265.05 |
| IUPAC Name | — |
| SMILES | C[Si](C)C(C)(C)C.O=S(=O)(O)C(F)(F)F |
| InChI | InChI=1S/C6H15Si.CHF3O3S/c1-6(2,3)7(4)5;2-1(3,4)8(5,6)7/h1-5H3;(H,5,6,7) |
| InChIKey | ANJDVAUBEAXAFE-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.35 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze CID 86627681 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 86627681?
The IUPAC name of CID 86627681 (CID 86627681) is not available.
What is the SMILES notation for CID 86627681?
The canonical SMILES for CID 86627681 is C[Si](C)C(C)(C)C.O=S(=O)(O)C(F)(F)F.
What is the InChIKey of CID 86627681?
The InChIKey is ANJDVAUBEAXAFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15Si.CHF3O3S/c1-6(2,3)7(4)5;2-1(3,4)8(5,6)7/h1-5H3;(H,5,6,7).
What are the key properties of CID 86627681?
CID 86627681 has a molecular weight of 265.35 g/mol, XLogP of 2.93, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 86627681 is sourced from PubChem (CID 86627681), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).