C32H39F3N6O4Si2 — CID 86627823
5-[3-[5-(trifluoromethoxy)-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]-1-(2-trimethylsilylethoxymethyl)pyrazolo[5,4-b]pyridin-5-yl]pyridine-3-carbaldehyde (PubChem CID 86627823) has the molecular formula C32H39F3N6O4Si2 and a molecular weight of 684.87 g/mol. Its IUPAC name is 5-[3-[5-(trifluoromethoxy)-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]-1-(2-trimethylsilylethoxymethyl)pyrazolo[5,4-b]pyridin-5-yl]pyridine-3-carbaldehyde.
| Compound Name | 5-[3-[5-(trifluoromethoxy)-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]-1-(2-trimethylsilylethoxymethyl)pyrazolo[5,4-b]pyridin-5-yl]pyridine-3-carbaldehyde |
|---|---|
| PubChem CID | 86627823 |
| Molecular Formula | C32H39F3N6O4Si2 |
| Molecular Weight | 684.87 g/mol |
| Exact Mass | 684.25 |
| IUPAC Name | 5-[3-[5-(trifluoromethoxy)-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]-1-(2-trimethylsilylethoxymethyl)pyrazolo[5,4-b]pyridin-5-yl]pyridine-3-carbaldehyde |
| SMILES | C[Si](C)(C)CCOCn1nc(-c2nc3cc(OC(F)(F)F)ccc3n2COCC[Si](C)(C)C)c2cc(-c3cncc(C=O)c3)cnc21 |
| InChI | InChI=1S/C32H39F3N6O4Si2/c1-46(2,3)11-9-43-20-40-28-8-7-25(45-32(33,34)35)15-27(28)38-31(40)29-26-14-24(23-13-22(19-42)16-36-17-23)18-37-30(26)41(39-29)21-44-10-12-47(4,5)6/h7-8,13-19H,9-12,20-21H2,1-6H3 |
| InChIKey | PCDNGLQOGBTEQX-UHFFFAOYSA-N |
| XLogP | 7.85 |
| TPSA | 106.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.87 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|