C30H43N5O3Si — CID 86627960
2-[[5-[1-azido-6-(2-ethyl-1,3-dioxolan-2-yl)hexyl]-2-naphthalen-2-ylimidazol-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 86627960) has the molecular formula C30H43N5O3Si and a molecular weight of 549.79 g/mol. Its IUPAC name is 2-[[5-[1-azido-6-(2-ethyl-1,3-dioxolan-2-yl)hexyl]-2-naphthalen-2-ylimidazol-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[5-[1-azido-6-(2-ethyl-1,3-dioxolan-2-yl)hexyl]-2-naphthalen-2-ylimidazol-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 86627960 |
| Molecular Formula | C30H43N5O3Si |
| Molecular Weight | 549.79 g/mol |
| Exact Mass | 549.31 |
| IUPAC Name | 2-[[5-[1-azido-6-(2-ethyl-1,3-dioxolan-2-yl)hexyl]-2-naphthalen-2-ylimidazol-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | CCC1(CCCCCC(N=[N+]=[N-])c2cnc(-c3ccc4ccccc4c3)n2COCC[Si](C)(C)C)OCCO1 |
| InChI | InChI=1S/C30H43N5O3Si/c1-5-30(37-17-18-38-30)16-10-6-7-13-27(33-34-31)28-22-32-29(35(28)23-36-19-20-39(2,3)4)26-15-14-24-11-8-9-12-25(24)21-26/h8-9,11-12,14-15,21-22,27H,5-7,10,13,16-20,23H2,1-4H3 |
| InChIKey | BIJPYSOCXOSYBK-UHFFFAOYSA-N |
| XLogP | 8.47 |
| TPSA | 94.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.79 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|