About triazolo[4,5-b]pyridin-3-yl 5-amino-3-ethyl-1-(thian-4-yl)pyrazole-4-carboxylate
triazolo[4,5-b]pyridin-3-yl 5-amino-3-ethyl-1-(thian-4-yl)pyrazole-4-carboxylate (PubChem CID 86628025) has the molecular formula C16H19N7O2S
and a molecular weight of 373.44 g/mol. Its IUPAC name is triazolo[4,5-b]pyridin-3-yl 5-amino-3-ethyl-1-(thian-4-yl)pyrazole-4-carboxylate.
Molecular Properties
| Compound Name | triazolo[4,5-b]pyridin-3-yl 5-amino-3-ethyl-1-(thian-4-yl)pyrazole-4-carboxylate |
| PubChem CID | 86628025 |
| Molecular Formula | C16H19N7O2S |
| Molecular Weight | 373.44 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | triazolo[4,5-b]pyridin-3-yl 5-amino-3-ethyl-1-(thian-4-yl)pyrazole-4-carboxylate |
| SMILES | CCc1nn(C2CCSCC2)c(N)c1C(=O)On1nnc2cccnc21 |
| InChI | InChI=1S/C16H19N7O2S/c1-2-11-13(14(17)22(20-11)10-5-8-26-9-6-10)16(24)25-23-15-12(19-21-23)4-3-7-18-15/h3-4,7,10H,2,5-6,8-9,17H2,1H3 |
| InChIKey | NOQZSMLJYZVADZ-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 113.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.44 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ester_of_HOBT', 'substructure': 'N/A'} |
|---|
Analyze triazolo[4,5-b]pyridin-3-yl 5-amino-3-ethyl-1-(thian-4-yl)pyrazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triazolo[4,5-b]pyridin-3-yl 5-amino-3-ethyl-1-(thian-4-yl)pyrazole-4-carboxylate?
The IUPAC name of triazolo[4,5-b]pyridin-3-yl 5-amino-3-ethyl-1-(thian-4-yl)pyrazole-4-carboxylate (CID 86628025) is triazolo[4,5-b]pyridin-3-yl 5-amino-3-ethyl-1-(thian-4-yl)pyrazole-4-carboxylate.
What is the SMILES notation for triazolo[4,5-b]pyridin-3-yl 5-amino-3-ethyl-1-(thian-4-yl)pyrazole-4-carboxylate?
The canonical SMILES for triazolo[4,5-b]pyridin-3-yl 5-amino-3-ethyl-1-(thian-4-yl)pyrazole-4-carboxylate is CCc1nn(C2CCSCC2)c(N)c1C(=O)On1nnc2cccnc21.
What is the InChIKey of triazolo[4,5-b]pyridin-3-yl 5-amino-3-ethyl-1-(thian-4-yl)pyrazole-4-carboxylate?
The InChIKey is NOQZSMLJYZVADZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19N7O2S/c1-2-11-13(14(17)22(20-11)10-5-8-26-9-6-10)16(24)25-23-15-12(19-21-23)4-3-7-18-15/h3-4,7,10H,2,5-6,8-9,17H2,1H3.
What are the key properties of triazolo[4,5-b]pyridin-3-yl 5-amino-3-ethyl-1-(thian-4-yl)pyrazole-4-carboxylate?
triazolo[4,5-b]pyridin-3-yl 5-amino-3-ethyl-1-(thian-4-yl)pyrazole-4-carboxylate has a molecular weight of 373.44 g/mol, XLogP of 1.50, 4 rotatable bonds, 1 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for triazolo[4,5-b]pyridin-3-yl 5-amino-3-ethyl-1-(thian-4-yl)pyrazole-4-carboxylate is sourced from PubChem (CID 86628025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).