C19H16Cl3N3O2 — CID 86628181
3-[1-[(5-cyano-2-pyridinyl)oxy]ethyl]-4-(3,4-dichlorophenyl)pyrrolidine-1-carbonyl chloride (PubChem CID 86628181) has the molecular formula C19H16Cl3N3O2 and a molecular weight of 424.72 g/mol. Its IUPAC name is 3-[1-[(5-cyano-2-pyridinyl)oxy]ethyl]-4-(3,4-dichlorophenyl)pyrrolidine-1-carbonyl chloride.
| Compound Name | 3-[1-[(5-cyano-2-pyridinyl)oxy]ethyl]-4-(3,4-dichlorophenyl)pyrrolidine-1-carbonyl chloride |
|---|---|
| PubChem CID | 86628181 |
| Molecular Formula | C19H16Cl3N3O2 |
| Molecular Weight | 424.72 g/mol |
| Exact Mass | 423.03 |
| IUPAC Name | 3-[1-[(5-cyano-2-pyridinyl)oxy]ethyl]-4-(3,4-dichlorophenyl)pyrrolidine-1-carbonyl chloride |
| SMILES | CC(Oc1ccc(C#N)cn1)C1CN(C(=O)Cl)CC1c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C19H16Cl3N3O2/c1-11(27-18-5-2-12(7-23)8-24-18)14-9-25(19(22)26)10-15(14)13-3-4-16(20)17(21)6-13/h2-6,8,11,14-15H,9-10H2,1H3 |
| InChIKey | MLYGYAZWKGBOIZ-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 66.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.72 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|