About 4-chloro-2-(dimethoxymethyl)-6,8-dihydro-5H-pyrido[2,3-d]pyrimidin-7-one
4-chloro-2-(dimethoxymethyl)-6,8-dihydro-5H-pyrido[2,3-d]pyrimidin-7-one (PubChem CID 86628369) has the molecular formula C10H12ClN3O3
and a molecular weight of 257.68 g/mol. Its IUPAC name is 4-chloro-2-(dimethoxymethyl)-6,8-dihydro-5H-pyrido[2,3-d]pyrimidin-7-one.
Molecular Properties
| Compound Name | 4-chloro-2-(dimethoxymethyl)-6,8-dihydro-5H-pyrido[2,3-d]pyrimidin-7-one |
| PubChem CID | 86628369 |
| Molecular Formula | C10H12ClN3O3 |
| Molecular Weight | 257.68 g/mol |
| Exact Mass | 257.06 |
| IUPAC Name | 4-chloro-2-(dimethoxymethyl)-6,8-dihydro-5H-pyrido[2,3-d]pyrimidin-7-one |
| SMILES | COC(OC)c1nc(Cl)c2c(n1)NC(=O)CC2 |
| InChI | InChI=1S/C10H12ClN3O3/c1-16-10(17-2)9-13-7(11)5-3-4-6(15)12-8(5)14-9/h10H,3-4H2,1-2H3,(H,12,13,14,15) |
| InChIKey | FDRYAJQOSZIIFJ-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.68 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-2-(dimethoxymethyl)-6,8-dihydro-5H-pyrido[2,3-d]pyrimidin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2-(dimethoxymethyl)-6,8-dihydro-5H-pyrido[2,3-d]pyrimidin-7-one?
The IUPAC name of 4-chloro-2-(dimethoxymethyl)-6,8-dihydro-5H-pyrido[2,3-d]pyrimidin-7-one (CID 86628369) is 4-chloro-2-(dimethoxymethyl)-6,8-dihydro-5H-pyrido[2,3-d]pyrimidin-7-one.
What is the SMILES notation for 4-chloro-2-(dimethoxymethyl)-6,8-dihydro-5H-pyrido[2,3-d]pyrimidin-7-one?
The canonical SMILES for 4-chloro-2-(dimethoxymethyl)-6,8-dihydro-5H-pyrido[2,3-d]pyrimidin-7-one is COC(OC)c1nc(Cl)c2c(n1)NC(=O)CC2.
What is the InChIKey of 4-chloro-2-(dimethoxymethyl)-6,8-dihydro-5H-pyrido[2,3-d]pyrimidin-7-one?
The InChIKey is FDRYAJQOSZIIFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12ClN3O3/c1-16-10(17-2)9-13-7(11)5-3-4-6(15)12-8(5)14-9/h10H,3-4H2,1-2H3,(H,12,13,14,15).
What are the key properties of 4-chloro-2-(dimethoxymethyl)-6,8-dihydro-5H-pyrido[2,3-d]pyrimidin-7-one?
4-chloro-2-(dimethoxymethyl)-6,8-dihydro-5H-pyrido[2,3-d]pyrimidin-7-one has a molecular weight of 257.68 g/mol, XLogP of 1.31, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2-(dimethoxymethyl)-6,8-dihydro-5H-pyrido[2,3-d]pyrimidin-7-one is sourced from PubChem (CID 86628369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).