C21H23N3O5S — CID 86628406
[2,2-dimethyl-3-[(3-nitroquinolin-4-yl)amino]propyl] 4-methylbenzenesulfonate (PubChem CID 86628406) has the molecular formula C21H23N3O5S and a molecular weight of 429.50 g/mol. Its IUPAC name is [2,2-dimethyl-3-[(3-nitroquinolin-4-yl)amino]propyl] 4-methylbenzenesulfonate.
| Compound Name | [2,2-dimethyl-3-[(3-nitroquinolin-4-yl)amino]propyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 86628406 |
| Molecular Formula | C21H23N3O5S |
| Molecular Weight | 429.50 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | [2,2-dimethyl-3-[(3-nitroquinolin-4-yl)amino]propyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC(C)(C)CNc2c([N+](=O)[O-])cnc3ccccc23)cc1 |
| InChI | InChI=1S/C21H23N3O5S/c1-15-8-10-16(11-9-15)30(27,28)29-14-21(2,3)13-23-20-17-6-4-5-7-18(17)22-12-19(20)24(25)26/h4-12H,13-14H2,1-3H3,(H,22,23) |
| InChIKey | KYHJWVBQNZIPJM-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 111.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.50 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|