C23H33N3O3 — CID 86628722
tert-butyl 2-[2-[(1-propan-2-ylpiperidin-4-yl)carbamoyl]indol-1-yl]acetate (PubChem CID 86628722) has the molecular formula C23H33N3O3 and a molecular weight of 399.54 g/mol. Its IUPAC name is tert-butyl 2-[2-[(1-propan-2-ylpiperidin-4-yl)carbamoyl]indol-1-yl]acetate.
| Compound Name | tert-butyl 2-[2-[(1-propan-2-ylpiperidin-4-yl)carbamoyl]indol-1-yl]acetate |
|---|---|
| PubChem CID | 86628722 |
| Molecular Formula | C23H33N3O3 |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 399.25 |
| IUPAC Name | tert-butyl 2-[2-[(1-propan-2-ylpiperidin-4-yl)carbamoyl]indol-1-yl]acetate |
| SMILES | CC(C)N1CCC(NC(=O)c2cc3ccccc3n2CC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C23H33N3O3/c1-16(2)25-12-10-18(11-13-25)24-22(28)20-14-17-8-6-7-9-19(17)26(20)15-21(27)29-23(3,4)5/h6-9,14,16,18H,10-13,15H2,1-5H3,(H,24,28) |
| InChIKey | BLGKZXNIJZYYRI-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |