About [(3S)-3-hydroxy-2,2-dimethylpent-4-enyl] 3-chloropropane-1-sulfonate
[(3S)-3-hydroxy-2,2-dimethylpent-4-enyl] 3-chloropropane-1-sulfonate (PubChem CID 86628877) has the molecular formula C10H19ClO4S
and a molecular weight of 270.78 g/mol. Its IUPAC name is [(3S)-3-hydroxy-2,2-dimethylpent-4-enyl] 3-chloropropane-1-sulfonate.
Molecular Properties
| Compound Name | [(3S)-3-hydroxy-2,2-dimethylpent-4-enyl] 3-chloropropane-1-sulfonate |
| PubChem CID | 86628877 |
| Molecular Formula | C10H19ClO4S |
| Molecular Weight | 270.78 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | [(3S)-3-hydroxy-2,2-dimethylpent-4-enyl] 3-chloropropane-1-sulfonate |
| SMILES | C=C[C@H](O)C(C)(C)COS(=O)(=O)CCCCl |
| InChI | InChI=1S/C10H19ClO4S/c1-4-9(12)10(2,3)8-15-16(13,14)7-5-6-11/h4,9,12H,1,5-8H2,2-3H3/t9-/m0/s1 |
| InChIKey | AOCZXWDLPLTFJZ-VIFPVBQESA-N |
| XLogP | 1.53 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.78 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [(3S)-3-hydroxy-2,2-dimethylpent-4-enyl] 3-chloropropane-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S)-3-hydroxy-2,2-dimethylpent-4-enyl] 3-chloropropane-1-sulfonate?
The IUPAC name of [(3S)-3-hydroxy-2,2-dimethylpent-4-enyl] 3-chloropropane-1-sulfonate (CID 86628877) is [(3S)-3-hydroxy-2,2-dimethylpent-4-enyl] 3-chloropropane-1-sulfonate.
What is the SMILES notation for [(3S)-3-hydroxy-2,2-dimethylpent-4-enyl] 3-chloropropane-1-sulfonate?
The canonical SMILES for [(3S)-3-hydroxy-2,2-dimethylpent-4-enyl] 3-chloropropane-1-sulfonate is C=C[C@H](O)C(C)(C)COS(=O)(=O)CCCCl.
What is the InChIKey of [(3S)-3-hydroxy-2,2-dimethylpent-4-enyl] 3-chloropropane-1-sulfonate?
The InChIKey is AOCZXWDLPLTFJZ-VIFPVBQESA-N. The full InChI is InChI=1S/C10H19ClO4S/c1-4-9(12)10(2,3)8-15-16(13,14)7-5-6-11/h4,9,12H,1,5-8H2,2-3H3/t9-/m0/s1.
What are the key properties of [(3S)-3-hydroxy-2,2-dimethylpent-4-enyl] 3-chloropropane-1-sulfonate?
[(3S)-3-hydroxy-2,2-dimethylpent-4-enyl] 3-chloropropane-1-sulfonate has a molecular weight of 270.78 g/mol, XLogP of 1.53, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S)-3-hydroxy-2,2-dimethylpent-4-enyl] 3-chloropropane-1-sulfonate is sourced from PubChem (CID 86628877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).