C25H29NO6S — CID 86628879
[(3S)-2,2-dimethyl-3-phenylmethoxypent-4-enyl] 3-(1,3-dioxoisoindol-2-yl)propane-1-sulfonate (PubChem CID 86628879) has the molecular formula C25H29NO6S and a molecular weight of 471.58 g/mol. Its IUPAC name is [(3S)-2,2-dimethyl-3-phenylmethoxypent-4-enyl] 3-(1,3-dioxoisoindol-2-yl)propane-1-sulfonate.
| Compound Name | [(3S)-2,2-dimethyl-3-phenylmethoxypent-4-enyl] 3-(1,3-dioxoisoindol-2-yl)propane-1-sulfonate |
|---|---|
| PubChem CID | 86628879 |
| Molecular Formula | C25H29NO6S |
| Molecular Weight | 471.58 g/mol |
| Exact Mass | 471.17 |
| IUPAC Name | [(3S)-2,2-dimethyl-3-phenylmethoxypent-4-enyl] 3-(1,3-dioxoisoindol-2-yl)propane-1-sulfonate |
| SMILES | C=C[C@H](OCc1ccccc1)C(C)(C)COS(=O)(=O)CCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C25H29NO6S/c1-4-22(31-17-19-11-6-5-7-12-19)25(2,3)18-32-33(29,30)16-10-15-26-23(27)20-13-8-9-14-21(20)24(26)28/h4-9,11-14,22H,1,10,15-18H2,2-3H3/t22-/m0/s1 |
| InChIKey | LWIGRRHBAOQNSS-QFIPXVFZSA-N |
| XLogP | 3.82 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.58 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|