C24H25ClF6N2O6S — CID 86629108
ethyl 1-[4-[3-[2-chloro-4-(trifluoromethylsulfonyloxy)phenyl]-1,1,1-trifluoro-2-hydroxybutan-2-yl]-2-pyridinyl]piperidine-4-carboxylate (PubChem CID 86629108) has the molecular formula C24H25ClF6N2O6S and a molecular weight of 618.98 g/mol. Its IUPAC name is ethyl 1-[4-[3-[2-chloro-4-(trifluoromethylsulfonyloxy)phenyl]-1,1,1-trifluoro-2-hydroxybutan-2-yl]-2-pyridinyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[4-[3-[2-chloro-4-(trifluoromethylsulfonyloxy)phenyl]-1,1,1-trifluoro-2-hydroxybutan-2-yl]-2-pyridinyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 86629108 |
| Molecular Formula | C24H25ClF6N2O6S |
| Molecular Weight | 618.98 g/mol |
| Exact Mass | 618.10 |
| IUPAC Name | ethyl 1-[4-[3-[2-chloro-4-(trifluoromethylsulfonyloxy)phenyl]-1,1,1-trifluoro-2-hydroxybutan-2-yl]-2-pyridinyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(c2cc(C(O)(C(C)c3ccc(OS(=O)(=O)C(F)(F)F)cc3Cl)C(F)(F)F)ccn2)CC1 |
| InChI | InChI=1S/C24H25ClF6N2O6S/c1-3-38-21(34)15-7-10-33(11-8-15)20-12-16(6-9-32-20)22(35,23(26,27)28)14(2)18-5-4-17(13-19(18)25)39-40(36,37)24(29,30)31/h4-6,9,12-15,35H,3,7-8,10-11H2,1-2H3 |
| InChIKey | PSHLRPMICDWBHV-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 106.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.98 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|