C22H18F3NO6S2 — CID 86629206
[2-methoxy-4-[2-(4-methoxyphenyl)-7-oxo-4,5-dihydrothieno[2,3-c]pyridin-6-yl]phenyl] trifluoromethanesulfonate (PubChem CID 86629206) has the molecular formula C22H18F3NO6S2 and a molecular weight of 513.52 g/mol. Its IUPAC name is [2-methoxy-4-[2-(4-methoxyphenyl)-7-oxo-4,5-dihydrothieno[2,3-c]pyridin-6-yl]phenyl] trifluoromethanesulfonate.
| Compound Name | [2-methoxy-4-[2-(4-methoxyphenyl)-7-oxo-4,5-dihydrothieno[2,3-c]pyridin-6-yl]phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 86629206 |
| Molecular Formula | C22H18F3NO6S2 |
| Molecular Weight | 513.52 g/mol |
| Exact Mass | 513.05 |
| IUPAC Name | [2-methoxy-4-[2-(4-methoxyphenyl)-7-oxo-4,5-dihydrothieno[2,3-c]pyridin-6-yl]phenyl] trifluoromethanesulfonate |
| SMILES | COc1ccc(-c2cc3c(s2)C(=O)N(c2ccc(OS(=O)(=O)C(F)(F)F)c(OC)c2)CC3)cc1 |
| InChI | InChI=1S/C22H18F3NO6S2/c1-30-16-6-3-13(4-7-16)19-11-14-9-10-26(21(27)20(14)33-19)15-5-8-17(18(12-15)31-2)32-34(28,29)22(23,24)25/h3-8,11-12H,9-10H2,1-2H3 |
| InChIKey | CVTFFSYDCMNHNP-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.52 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|