C20H17F3N6O2 — CID 86629371
3-[6-(4-isocyanatophenyl)-1-(2,2,2-trifluoroethyl)pyrazolo[5,4-d]pyrimidin-4-yl]-8-oxa-3-azabicyclo[3.2.1]octane (PubChem CID 86629371) has the molecular formula C20H17F3N6O2 and a molecular weight of 430.39 g/mol. Its IUPAC name is 3-[6-(4-isocyanatophenyl)-1-(2,2,2-trifluoroethyl)pyrazolo[5,4-d]pyrimidin-4-yl]-8-oxa-3-azabicyclo[3.2.1]octane.
| Compound Name | 3-[6-(4-isocyanatophenyl)-1-(2,2,2-trifluoroethyl)pyrazolo[5,4-d]pyrimidin-4-yl]-8-oxa-3-azabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 86629371 |
| Molecular Formula | C20H17F3N6O2 |
| Molecular Weight | 430.39 g/mol |
| Exact Mass | 430.14 |
| IUPAC Name | 3-[6-(4-isocyanatophenyl)-1-(2,2,2-trifluoroethyl)pyrazolo[5,4-d]pyrimidin-4-yl]-8-oxa-3-azabicyclo[3.2.1]octane |
| SMILES | O=C=Nc1ccc(-c2nc(N3CC4CCC(C3)O4)c3cnn(CC(F)(F)F)c3n2)cc1 |
| InChI | InChI=1S/C20H17F3N6O2/c21-20(22,23)10-29-19-16(7-25-29)18(28-8-14-5-6-15(9-28)31-14)26-17(27-19)12-1-3-13(4-2-12)24-11-30/h1-4,7,14-15H,5-6,8-10H2 |
| InChIKey | YEOARSOUBSRKQM-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 85.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.39 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|