C22H31ClN4OS — CID 86629522
6-chloro-2,4-dimethyl-N-[(3R)-3-[4-(thiophen-3-ylmethylamino)piperidin-1-yl]butyl]pyridine-3-carboxamide (PubChem CID 86629522) has the molecular formula C22H31ClN4OS and a molecular weight of 435.04 g/mol. Its IUPAC name is 6-chloro-2,4-dimethyl-N-[(3R)-3-[4-(thiophen-3-ylmethylamino)piperidin-1-yl]butyl]pyridine-3-carboxamide.
| Compound Name | 6-chloro-2,4-dimethyl-N-[(3R)-3-[4-(thiophen-3-ylmethylamino)piperidin-1-yl]butyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 86629522 |
| Molecular Formula | C22H31ClN4OS |
| Molecular Weight | 435.04 g/mol |
| Exact Mass | 434.19 |
| IUPAC Name | 6-chloro-2,4-dimethyl-N-[(3R)-3-[4-(thiophen-3-ylmethylamino)piperidin-1-yl]butyl]pyridine-3-carboxamide |
| SMILES | Cc1cc(Cl)nc(C)c1C(=O)NCC[C@@H](C)N1CCC(NCc2ccsc2)CC1 |
| InChI | InChI=1S/C22H31ClN4OS/c1-15-12-20(23)26-17(3)21(15)22(28)24-8-4-16(2)27-9-5-19(6-10-27)25-13-18-7-11-29-14-18/h7,11-12,14,16,19,25H,4-6,8-10,13H2,1-3H3,(H,24,28)/t16-/m1/s1 |
| InChIKey | DRHXZZNVJLPWRV-MRXNPFEDSA-N |
| XLogP | 4.18 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.04 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|