1,5-dimethyl-3-(trifluoromethyl)pyrazole-4-carbonyl chloride

C7H6ClF3N2O — CID 86629852

IUPAC1,5-dimethyl-3-(trifluoromethyl)pyrazole-4-carbonyl chloride
SMILESCc1c(C(=O)Cl)c(C(F)(F)F)nn1C
InChIInChI=1S/C7H6ClF3N2O/c1-3-4(6(8)14)5(7(9,10)11)12-13(3)2/h1-2H3
InChIKeyHCSXBEQRQIGEIM-UHFFFAOYSA-N
MW226.58 g/mol
LogP2.13
Rot. Bonds1

About 1,5-dimethyl-3-(trifluoromethyl)pyrazole-4-carbonyl chloride

1,5-dimethyl-3-(trifluoromethyl)pyrazole-4-carbonyl chloride (PubChem CID 86629852) has the molecular formula C7H6ClF3N2O and a molecular weight of 226.58 g/mol. Its IUPAC name is 1,5-dimethyl-3-(trifluoromethyl)pyrazole-4-carbonyl chloride.

Molecular Properties

Compound Name1,5-dimethyl-3-(trifluoromethyl)pyrazole-4-carbonyl chloride
PubChem CID86629852
Molecular FormulaC7H6ClF3N2O
Molecular Weight226.58 g/mol
Exact Mass226.01
IUPAC Name1,5-dimethyl-3-(trifluoromethyl)pyrazole-4-carbonyl chloride
SMILESCc1c(C(=O)Cl)c(C(F)(F)F)nn1C
InChIInChI=1S/C7H6ClF3N2O/c1-3-4(6(8)14)5(7(9,10)11)12-13(3)2/h1-2H3
InChIKeyHCSXBEQRQIGEIM-UHFFFAOYSA-N
XLogP2.13
TPSA34.89 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500226.58
LogP ≤ 52.13
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze 1,5-dimethyl-3-(trifluoromethyl)pyrazole-4-carbonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,5-dimethyl-3-(trifluoromethyl)pyrazole-4-carbonyl chloride?
The IUPAC name of 1,5-dimethyl-3-(trifluoromethyl)pyrazole-4-carbonyl chloride (CID 86629852) is 1,5-dimethyl-3-(trifluoromethyl)pyrazole-4-carbonyl chloride.
What is the SMILES notation for 1,5-dimethyl-3-(trifluoromethyl)pyrazole-4-carbonyl chloride?
The canonical SMILES for 1,5-dimethyl-3-(trifluoromethyl)pyrazole-4-carbonyl chloride is Cc1c(C(=O)Cl)c(C(F)(F)F)nn1C.
What is the InChIKey of 1,5-dimethyl-3-(trifluoromethyl)pyrazole-4-carbonyl chloride?
The InChIKey is HCSXBEQRQIGEIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6ClF3N2O/c1-3-4(6(8)14)5(7(9,10)11)12-13(3)2/h1-2H3.
What are the key properties of 1,5-dimethyl-3-(trifluoromethyl)pyrazole-4-carbonyl chloride?
1,5-dimethyl-3-(trifluoromethyl)pyrazole-4-carbonyl chloride has a molecular weight of 226.58 g/mol, XLogP of 2.13, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-dimethyl-3-(trifluoromethyl)pyrazole-4-carbonyl chloride is sourced from PubChem (CID 86629852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).