C16H18FNO3 — CID 86630250
tert-butyl N-(2-fluorophenyl)-N-pent-4-ynoylcarbamate (PubChem CID 86630250) has the molecular formula C16H18FNO3 and a molecular weight of 291.32 g/mol. Its IUPAC name is tert-butyl N-(2-fluorophenyl)-N-pent-4-ynoylcarbamate.
| Compound Name | tert-butyl N-(2-fluorophenyl)-N-pent-4-ynoylcarbamate |
|---|---|
| PubChem CID | 86630250 |
| Molecular Formula | C16H18FNO3 |
| Molecular Weight | 291.32 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | tert-butyl N-(2-fluorophenyl)-N-pent-4-ynoylcarbamate |
| SMILES | C#CCCC(=O)N(C(=O)OC(C)(C)C)c1ccccc1F |
| InChI | InChI=1S/C16H18FNO3/c1-5-6-11-14(19)18(15(20)21-16(2,3)4)13-10-8-7-9-12(13)17/h1,7-10H,6,11H2,2-4H3 |
| InChIKey | WJPJGIQFNAVXKA-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.32 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|