C19H14N4O2 — CID 86630263
4-[(6-ethynyl-[1,2,4]triazolo[4,3-a]pyridin-3-yl)methoxy]-7-methoxyquinoline (PubChem CID 86630263) has the molecular formula C19H14N4O2 and a molecular weight of 330.35 g/mol. Its IUPAC name is 4-[(6-ethynyl-[1,2,4]triazolo[4,3-a]pyridin-3-yl)methoxy]-7-methoxyquinoline.
| Compound Name | 4-[(6-ethynyl-[1,2,4]triazolo[4,3-a]pyridin-3-yl)methoxy]-7-methoxyquinoline |
|---|---|
| PubChem CID | 86630263 |
| Molecular Formula | C19H14N4O2 |
| Molecular Weight | 330.35 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | 4-[(6-ethynyl-[1,2,4]triazolo[4,3-a]pyridin-3-yl)methoxy]-7-methoxyquinoline |
| SMILES | C#Cc1ccc2nnc(COc3ccnc4cc(OC)ccc34)n2c1 |
| InChI | InChI=1S/C19H14N4O2/c1-3-13-4-7-18-21-22-19(23(18)11-13)12-25-17-8-9-20-16-10-14(24-2)5-6-15(16)17/h1,4-11H,12H2,2H3 |
| InChIKey | RYHZRAQXKYQCBY-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 61.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.35 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|