C33H42ClN5O8S — CID 86630362
(3S)-N-(6-chloro-9H-pyrido[3,4-b]indol-8-yl)-4-[2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-2-oxoethyl]-6,6-dimethylmorpholine-3-carboxamide;4-methylbenzenesulfonic acid;hydrate (PubChem CID 86630362) has the molecular formula C33H42ClN5O8S and a molecular weight of 704.25 g/mol. Its IUPAC name is (3S)-N-(6-chloro-9H-pyrido[3,4-b]indol-8-yl)-4-[2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-2-oxoethyl]-6,6-dimethylmorpholine-3-carboxamide;4-methylbenzenesulfonic acid;hydrate.
| Compound Name | (3S)-N-(6-chloro-9H-pyrido[3,4-b]indol-8-yl)-4-[2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-2-oxoethyl]-6,6-dimethylmorpholine-3-carboxamide;4-methylbenzenesulfonic acid;hydrate |
|---|---|
| PubChem CID | 86630362 |
| Molecular Formula | C33H42ClN5O8S |
| Molecular Weight | 704.25 g/mol |
| Exact Mass | 703.24 |
| IUPAC Name | (3S)-N-(6-chloro-9H-pyrido[3,4-b]indol-8-yl)-4-[2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-2-oxoethyl]-6,6-dimethylmorpholine-3-carboxamide;4-methylbenzenesulfonic acid;hydrate |
| SMILES | C[C@@H]1CN(C(=O)CN2CC(C)(C)OC[C@H]2C(=O)Nc2cc(Cl)cc3c2[nH]c2cnccc23)C[C@H](C)O1.Cc1ccc(S(=O)(=O)O)cc1.O |
| InChI | InChI=1S/C26H32ClN5O4.C7H8O3S.H2O/c1-15-10-31(11-16(2)36-15)23(33)12-32-14-26(3,4)35-13-22(32)25(34)30-20-8-17(27)7-19-18-5-6-28-9-21(18)29-24(19)20;1-6-2-4-7(5-3-6)11(8,9)10;/h5-9,15-16,22,29H,10-14H2,1-4H3,(H,30,34);2-5H,1H3,(H,8,9,10);1H2/t15-,16+,22-;;/m0../s1 |
| InChIKey | XUXGOWQOVIPCJL-OSZMYQJASA-N |
| XLogP | 3.84 |
| TPSA | 185.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.25 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|