About (6-cyano-1,7-naphthyridin-4-yl) trifluoromethanesulfonate
(6-cyano-1,7-naphthyridin-4-yl) trifluoromethanesulfonate (PubChem CID 86630421) has the molecular formula C10H4F3N3O3S
and a molecular weight of 303.22 g/mol. Its IUPAC name is (6-cyano-1,7-naphthyridin-4-yl) trifluoromethanesulfonate.
Molecular Properties
| Compound Name | (6-cyano-1,7-naphthyridin-4-yl) trifluoromethanesulfonate |
| PubChem CID | 86630421 |
| Molecular Formula | C10H4F3N3O3S |
| Molecular Weight | 303.22 g/mol |
| Exact Mass | 302.99 |
| IUPAC Name | (6-cyano-1,7-naphthyridin-4-yl) trifluoromethanesulfonate |
| SMILES | N#Cc1cc2c(OS(=O)(=O)C(F)(F)F)ccnc2cn1 |
| InChI | InChI=1S/C10H4F3N3O3S/c11-10(12,13)20(17,18)19-9-1-2-15-8-5-16-6(4-14)3-7(8)9/h1-3,5H |
| InChIKey | YTMSDQJMMTVHOC-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 92.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.22 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze (6-cyano-1,7-naphthyridin-4-yl) trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-cyano-1,7-naphthyridin-4-yl) trifluoromethanesulfonate?
The IUPAC name of (6-cyano-1,7-naphthyridin-4-yl) trifluoromethanesulfonate (CID 86630421) is (6-cyano-1,7-naphthyridin-4-yl) trifluoromethanesulfonate.
What is the SMILES notation for (6-cyano-1,7-naphthyridin-4-yl) trifluoromethanesulfonate?
The canonical SMILES for (6-cyano-1,7-naphthyridin-4-yl) trifluoromethanesulfonate is N#Cc1cc2c(OS(=O)(=O)C(F)(F)F)ccnc2cn1.
What is the InChIKey of (6-cyano-1,7-naphthyridin-4-yl) trifluoromethanesulfonate?
The InChIKey is YTMSDQJMMTVHOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H4F3N3O3S/c11-10(12,13)20(17,18)19-9-1-2-15-8-5-16-6(4-14)3-7(8)9/h1-3,5H.
What are the key properties of (6-cyano-1,7-naphthyridin-4-yl) trifluoromethanesulfonate?
(6-cyano-1,7-naphthyridin-4-yl) trifluoromethanesulfonate has a molecular weight of 303.22 g/mol, XLogP of 1.73, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (6-cyano-1,7-naphthyridin-4-yl) trifluoromethanesulfonate is sourced from PubChem (CID 86630421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).