C25H26F3N3O6S — CID 86630481
3-[5-[(3-cyclopropyl-1,2-oxazol-5-yl)methylcarbamoyl]-2-methyl-6-oxo-1-[3-(trifluoromethyl)phenyl]-3-pyridinyl]propyl methanesulfonate (PubChem CID 86630481) has the molecular formula C25H26F3N3O6S and a molecular weight of 553.56 g/mol. Its IUPAC name is 3-[5-[(3-cyclopropyl-1,2-oxazol-5-yl)methylcarbamoyl]-2-methyl-6-oxo-1-[3-(trifluoromethyl)phenyl]-3-pyridinyl]propyl methanesulfonate.
| Compound Name | 3-[5-[(3-cyclopropyl-1,2-oxazol-5-yl)methylcarbamoyl]-2-methyl-6-oxo-1-[3-(trifluoromethyl)phenyl]-3-pyridinyl]propyl methanesulfonate |
|---|---|
| PubChem CID | 86630481 |
| Molecular Formula | C25H26F3N3O6S |
| Molecular Weight | 553.56 g/mol |
| Exact Mass | 553.15 |
| IUPAC Name | 3-[5-[(3-cyclopropyl-1,2-oxazol-5-yl)methylcarbamoyl]-2-methyl-6-oxo-1-[3-(trifluoromethyl)phenyl]-3-pyridinyl]propyl methanesulfonate |
| SMILES | Cc1c(CCCOS(C)(=O)=O)cc(C(=O)NCc2cc(C3CC3)no2)c(=O)n1-c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C25H26F3N3O6S/c1-15-17(5-4-10-36-38(2,34)35)11-21(23(32)29-14-20-13-22(30-37-20)16-8-9-16)24(33)31(15)19-7-3-6-18(12-19)25(26,27)28/h3,6-7,11-13,16H,4-5,8-10,14H2,1-2H3,(H,29,32) |
| InChIKey | ARNQCAYOFZDTSW-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 120.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.56 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|