C37H38N6O8 — CID 86630724
N-[9-[(2R,3R,4R,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3-(2-cyanoethoxymethoxy)-4-hydroxyoxolan-2-yl]purin-6-yl]acetamide (PubChem CID 86630724) has the molecular formula C37H38N6O8 and a molecular weight of 694.75 g/mol. Its IUPAC name is N-[9-[(2R,3R,4R,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3-(2-cyanoethoxymethoxy)-4-hydroxyoxolan-2-yl]purin-6-yl]acetamide.
| Compound Name | N-[9-[(2R,3R,4R,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3-(2-cyanoethoxymethoxy)-4-hydroxyoxolan-2-yl]purin-6-yl]acetamide |
|---|---|
| PubChem CID | 86630724 |
| Molecular Formula | C37H38N6O8 |
| Molecular Weight | 694.75 g/mol |
| Exact Mass | 694.28 |
| IUPAC Name | N-[9-[(2R,3R,4R,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3-(2-cyanoethoxymethoxy)-4-hydroxyoxolan-2-yl]purin-6-yl]acetamide |
| SMILES | COc1ccc(C(OC[C@H]2O[C@@H](n3cnc4c(NC(C)=O)ncnc43)[C@H](OCOCCC#N)[C@@H]2O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C37H38N6O8/c1-24(44)42-34-31-35(40-21-39-34)43(22-41-31)36-33(49-23-48-19-7-18-38)32(45)30(51-36)20-50-37(25-8-5-4-6-9-25,26-10-14-28(46-2)15-11-26)27-12-16-29(47-3)17-13-27/h4-6,8-17,21-22,30,32-33,36,45H,7,19-20,23H2,1-3H3,(H,39,40,42,44)/t30-,32-,33-,36-/m1/s1 |
| InChIKey | IQUBNLVPESSAFU-QGGAYTEESA-N |
| XLogP | 4.34 |
| TPSA | 172.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.75 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|