C26H28Cl3N3O3 — CID 86631399
4-chloro-N-[(3R,4R)-3-(3,4-dichlorophenyl)-1-(1-formylpiperidine-4-carbonyl)piperidin-4-yl]-N-methylbenzamide (PubChem CID 86631399) has the molecular formula C26H28Cl3N3O3 and a molecular weight of 536.89 g/mol. Its IUPAC name is 4-chloro-N-[(3R,4R)-3-(3,4-dichlorophenyl)-1-(1-formylpiperidine-4-carbonyl)piperidin-4-yl]-N-methylbenzamide.
| Compound Name | 4-chloro-N-[(3R,4R)-3-(3,4-dichlorophenyl)-1-(1-formylpiperidine-4-carbonyl)piperidin-4-yl]-N-methylbenzamide |
|---|---|
| PubChem CID | 86631399 |
| Molecular Formula | C26H28Cl3N3O3 |
| Molecular Weight | 536.89 g/mol |
| Exact Mass | 535.12 |
| IUPAC Name | 4-chloro-N-[(3R,4R)-3-(3,4-dichlorophenyl)-1-(1-formylpiperidine-4-carbonyl)piperidin-4-yl]-N-methylbenzamide |
| SMILES | CN(C(=O)c1ccc(Cl)cc1)[C@@H]1CCN(C(=O)C2CCN(C=O)CC2)C[C@H]1c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C26H28Cl3N3O3/c1-30(25(34)17-2-5-20(27)6-3-17)24-10-13-32(26(35)18-8-11-31(16-33)12-9-18)15-21(24)19-4-7-22(28)23(29)14-19/h2-7,14,16,18,21,24H,8-13,15H2,1H3/t21-,24+/m0/s1 |
| InChIKey | WGDPTZYXMXWZEG-XUZZJYLKSA-N |
| XLogP | 4.97 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.89 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|