C23H38N6 — CID 86632513
2-[[3-(2-methylpyrrolidin-1-yl)propylamino]-[4-(piperidin-1-ylmethyl)piperidin-1-yl]methylidene]propanedinitrile (PubChem CID 86632513) has the molecular formula C23H38N6 and a molecular weight of 398.60 g/mol. Its IUPAC name is 2-[[3-(2-methylpyrrolidin-1-yl)propylamino]-[4-(piperidin-1-ylmethyl)piperidin-1-yl]methylidene]propanedinitrile.
| Compound Name | 2-[[3-(2-methylpyrrolidin-1-yl)propylamino]-[4-(piperidin-1-ylmethyl)piperidin-1-yl]methylidene]propanedinitrile |
|---|---|
| PubChem CID | 86632513 |
| Molecular Formula | C23H38N6 |
| Molecular Weight | 398.60 g/mol |
| Exact Mass | 398.32 |
| IUPAC Name | 2-[[3-(2-methylpyrrolidin-1-yl)propylamino]-[4-(piperidin-1-ylmethyl)piperidin-1-yl]methylidene]propanedinitrile |
| SMILES | CC1CCCN1CCCNC(=C(C#N)C#N)N1CCC(CN2CCCCC2)CC1 |
| InChI | InChI=1S/C23H38N6/c1-20-7-5-13-28(20)14-6-10-26-23(22(17-24)18-25)29-15-8-21(9-16-29)19-27-11-3-2-4-12-27/h20-21,26H,2-16,19H2,1H3 |
| InChIKey | GYTPHHFVMJEWAV-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 69.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.60 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|