C29H43N7O3Si — CID 86632620
tert-butyl N-[[1-[2-cyano-1-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]ethyl]cyclopentyl]methyl]carbamate (PubChem CID 86632620) has the molecular formula C29H43N7O3Si and a molecular weight of 565.80 g/mol. Its IUPAC name is tert-butyl N-[[1-[2-cyano-1-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]ethyl]cyclopentyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[1-[2-cyano-1-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]ethyl]cyclopentyl]methyl]carbamate |
|---|---|
| PubChem CID | 86632620 |
| Molecular Formula | C29H43N7O3Si |
| Molecular Weight | 565.80 g/mol |
| Exact Mass | 565.32 |
| IUPAC Name | tert-butyl N-[[1-[2-cyano-1-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]ethyl]cyclopentyl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC1(C(CC#N)n2cc(-c3ncnc4c3ccn4COCC[Si](C)(C)C)cn2)CCCC1 |
| InChI | InChI=1S/C29H43N7O3Si/c1-28(2,3)39-27(37)31-19-29(11-7-8-12-29)24(9-13-30)36-18-22(17-34-36)25-23-10-14-35(26(23)33-20-32-25)21-38-15-16-40(4,5)6/h10,14,17-18,20,24H,7-9,11-12,15-16,19,21H2,1-6H3,(H,31,37) |
| InChIKey | VYSPGOKPLVNEAD-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 119.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.80 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|