C25H26F2O5S2 — CID 86632753
2-(2,2-dimethylpropanoyloxy)-1,1-difluoroethanesulfonate;triphenylsulfanium (PubChem CID 86632753) has the molecular formula C25H26F2O5S2 and a molecular weight of 508.61 g/mol. Its IUPAC name is 2-(2,2-dimethylpropanoyloxy)-1,1-difluoroethanesulfonate;triphenylsulfanium.
| Compound Name | 2-(2,2-dimethylpropanoyloxy)-1,1-difluoroethanesulfonate;triphenylsulfanium |
|---|---|
| PubChem CID | 86632753 |
| Molecular Formula | C25H26F2O5S2 |
| Molecular Weight | 508.61 g/mol |
| Exact Mass | 508.12 |
| IUPAC Name | 2-(2,2-dimethylpropanoyloxy)-1,1-difluoroethanesulfonate;triphenylsulfanium |
| SMILES | CC(C)(C)C(=O)OCC(F)(F)S(=O)(=O)[O-].c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15S.C7H12F2O5S/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-6(2,3)5(10)14-4-7(8,9)15(11,12)13/h1-15H;4H2,1-3H3,(H,11,12,13)/q+1;/p-1 |
| InChIKey | JYGWXKFFFZSUOD-UHFFFAOYSA-M |
| XLogP | 5.50 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.61 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|