About 1,1-difluoro-2-hydroxyethanesulfonate;triphenylsulfanium
1,1-difluoro-2-hydroxyethanesulfonate;triphenylsulfanium (PubChem CID 86632756) has the molecular formula C20H18F2O4S2
and a molecular weight of 424.49 g/mol. Its IUPAC name is 1,1-difluoro-2-hydroxyethanesulfonate;triphenylsulfanium.
Molecular Properties
| Compound Name | 1,1-difluoro-2-hydroxyethanesulfonate;triphenylsulfanium |
| PubChem CID | 86632756 |
| Molecular Formula | C20H18F2O4S2 |
| Molecular Weight | 424.49 g/mol |
| Exact Mass | 424.06 |
| IUPAC Name | 1,1-difluoro-2-hydroxyethanesulfonate;triphenylsulfanium |
| SMILES | O=S(=O)([O-])C(F)(F)CO.c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15S.C2H4F2O4S/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;3-2(4,1-5)9(6,7)8/h1-15H;5H,1H2,(H,6,7,8)/q+1;/p-1 |
| InChIKey | NQECNQVTAPRTRZ-UHFFFAOYSA-M |
| XLogP | 3.90 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 424.49 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 1,1-difluoro-2-hydroxyethanesulfonate;triphenylsulfanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-difluoro-2-hydroxyethanesulfonate;triphenylsulfanium?
The IUPAC name of 1,1-difluoro-2-hydroxyethanesulfonate;triphenylsulfanium (CID 86632756) is 1,1-difluoro-2-hydroxyethanesulfonate;triphenylsulfanium.
What is the SMILES notation for 1,1-difluoro-2-hydroxyethanesulfonate;triphenylsulfanium?
The canonical SMILES for 1,1-difluoro-2-hydroxyethanesulfonate;triphenylsulfanium is O=S(=O)([O-])C(F)(F)CO.c1ccc([S+](c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of 1,1-difluoro-2-hydroxyethanesulfonate;triphenylsulfanium?
The InChIKey is NQECNQVTAPRTRZ-UHFFFAOYSA-M. The full InChI is InChI=1S/C18H15S.C2H4F2O4S/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;3-2(4,1-5)9(6,7)8/h1-15H;5H,1H2,(H,6,7,8)/q+1;/p-1.
What are the key properties of 1,1-difluoro-2-hydroxyethanesulfonate;triphenylsulfanium?
1,1-difluoro-2-hydroxyethanesulfonate;triphenylsulfanium has a molecular weight of 424.49 g/mol, XLogP of 3.90, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-difluoro-2-hydroxyethanesulfonate;triphenylsulfanium is sourced from PubChem (CID 86632756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).