C10H12F8O4S — CID 86632847
5,5,6,6,6-pentafluoro-2-methyl-2-(3,3,3-trifluoropropylsulfonyl)hexanoic acid (PubChem CID 86632847) has the molecular formula C10H12F8O4S and a molecular weight of 380.25 g/mol. Its IUPAC name is 5,5,6,6,6-pentafluoro-2-methyl-2-(3,3,3-trifluoropropylsulfonyl)hexanoic acid.
| Compound Name | 5,5,6,6,6-pentafluoro-2-methyl-2-(3,3,3-trifluoropropylsulfonyl)hexanoic acid |
|---|---|
| PubChem CID | 86632847 |
| Molecular Formula | C10H12F8O4S |
| Molecular Weight | 380.25 g/mol |
| Exact Mass | 380.03 |
| IUPAC Name | 5,5,6,6,6-pentafluoro-2-methyl-2-(3,3,3-trifluoropropylsulfonyl)hexanoic acid |
| SMILES | CC(CCC(F)(F)C(F)(F)F)(C(=O)O)S(=O)(=O)CCC(F)(F)F |
| InChI | InChI=1S/C10H12F8O4S/c1-7(6(19)20,2-3-8(11,12)10(16,17)18)23(21,22)5-4-9(13,14)15/h2-5H2,1H3,(H,19,20) |
| InChIKey | ICGUHDXIFQDZFL-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.25 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|