C11H14F8O4S — CID 86632848
2-ethyl-5,5,6,6,6-pentafluoro-2-(3,3,3-trifluoropropylsulfonyl)hexanoic acid (PubChem CID 86632848) has the molecular formula C11H14F8O4S and a molecular weight of 394.28 g/mol. Its IUPAC name is 2-ethyl-5,5,6,6,6-pentafluoro-2-(3,3,3-trifluoropropylsulfonyl)hexanoic acid.
| Compound Name | 2-ethyl-5,5,6,6,6-pentafluoro-2-(3,3,3-trifluoropropylsulfonyl)hexanoic acid |
|---|---|
| PubChem CID | 86632848 |
| Molecular Formula | C11H14F8O4S |
| Molecular Weight | 394.28 g/mol |
| Exact Mass | 394.05 |
| IUPAC Name | 2-ethyl-5,5,6,6,6-pentafluoro-2-(3,3,3-trifluoropropylsulfonyl)hexanoic acid |
| SMILES | CCC(CCC(F)(F)C(F)(F)F)(C(=O)O)S(=O)(=O)CCC(F)(F)F |
| InChI | InChI=1S/C11H14F8O4S/c1-2-8(7(20)21,3-4-9(12,13)11(17,18)19)24(22,23)6-5-10(14,15)16/h2-6H2,1H3,(H,20,21) |
| InChIKey | BEWHHPQEXZPXSB-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.28 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|