C12H12F12O4S — CID 86632850
5,5,6,6,7,7,7-heptafluoro-2-methyl-2-(3,3,4,4,4-pentafluorobutylsulfonyl)heptanoic acid (PubChem CID 86632850) has the molecular formula C12H12F12O4S and a molecular weight of 480.27 g/mol. Its IUPAC name is 5,5,6,6,7,7,7-heptafluoro-2-methyl-2-(3,3,4,4,4-pentafluorobutylsulfonyl)heptanoic acid.
| Compound Name | 5,5,6,6,7,7,7-heptafluoro-2-methyl-2-(3,3,4,4,4-pentafluorobutylsulfonyl)heptanoic acid |
|---|---|
| PubChem CID | 86632850 |
| Molecular Formula | C12H12F12O4S |
| Molecular Weight | 480.27 g/mol |
| Exact Mass | 480.03 |
| IUPAC Name | 5,5,6,6,7,7,7-heptafluoro-2-methyl-2-(3,3,4,4,4-pentafluorobutylsulfonyl)heptanoic acid |
| SMILES | CC(CCC(F)(F)C(F)(F)C(F)(F)F)(C(=O)O)S(=O)(=O)CCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H12F12O4S/c1-7(6(25)26,2-3-8(13,14)10(17,18)12(22,23)24)29(27,28)5-4-9(15,16)11(19,20)21/h2-5H2,1H3,(H,25,26) |
| InChIKey | KGLRGRAEUAVSCX-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.27 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|