C24H28F3NO4 — CID 86633243
tert-butyl 4-[(1Z,3E)-5-ethoxy-5-oxo-1-[4-(trifluoromethyl)phenyl]penta-1,3-dienyl]-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 86633243) has the molecular formula C24H28F3NO4 and a molecular weight of 451.49 g/mol. Its IUPAC name is tert-butyl 4-[(1Z,3E)-5-ethoxy-5-oxo-1-[4-(trifluoromethyl)phenyl]penta-1,3-dienyl]-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | tert-butyl 4-[(1Z,3E)-5-ethoxy-5-oxo-1-[4-(trifluoromethyl)phenyl]penta-1,3-dienyl]-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 86633243 |
| Molecular Formula | C24H28F3NO4 |
| Molecular Weight | 451.49 g/mol |
| Exact Mass | 451.20 |
| IUPAC Name | tert-butyl 4-[(1Z,3E)-5-ethoxy-5-oxo-1-[4-(trifluoromethyl)phenyl]penta-1,3-dienyl]-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | CCOC(=O)/C=C/C=C(/C1=CCN(C(=O)OC(C)(C)C)CC1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C24H28F3NO4/c1-5-31-21(29)8-6-7-20(17-9-11-19(12-10-17)24(25,26)27)18-13-15-28(16-14-18)22(30)32-23(2,3)4/h6-13H,5,14-16H2,1-4H3/b8-6+,20-7+ |
| InChIKey | PZFUSKOVBNDWEQ-PRNXGPNWSA-N |
| XLogP | 5.78 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.49 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|