C23H29ClN4O2Si — CID 86633631
CID 86633631 (PubChem CID 86633631) has the molecular formula C23H29ClN4O2Si and a molecular weight of 457.05 g/mol.
| Compound Name | CID 86633631 |
|---|---|
| PubChem CID | 86633631 |
| Molecular Formula | C23H29ClN4O2Si |
| Molecular Weight | 457.05 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | — |
| SMILES | COc1cc(Nc2cc(C(C)(C)O[Si]C(C)(C)C)cc(Cl)n2)ccc1-n1cnc(C)c1 |
| InChI | InChI=1S/C23H29ClN4O2Si/c1-15-13-28(14-25-15)18-9-8-17(12-19(18)29-7)26-21-11-16(10-20(24)27-21)23(5,6)30-31-22(2,3)4/h8-14H,1-7H3,(H,26,27) |
| InChIKey | CLMKHQPLUDGECU-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 61.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.05 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|