C14H14Cl2N4S — CID 866338
6-tert-butyl-3-(2,4-dichlorophenyl)-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine (PubChem CID 866338) has the molecular formula C14H14Cl2N4S and a molecular weight of 341.27 g/mol. Its IUPAC name is 6-tert-butyl-3-(2,4-dichlorophenyl)-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine.
| Compound Name | 6-tert-butyl-3-(2,4-dichlorophenyl)-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine |
|---|---|
| PubChem CID | 866338 |
| Molecular Formula | C14H14Cl2N4S |
| Molecular Weight | 341.27 g/mol |
| Exact Mass | 340.03 |
| IUPAC Name | 6-tert-butyl-3-(2,4-dichlorophenyl)-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine |
| SMILES | CC(C)(C)C1=Nn2c(nnc2-c2ccc(Cl)cc2Cl)SC1 |
| InChI | InChI=1S/C14H14Cl2N4S/c1-14(2,3)11-7-21-13-18-17-12(20(13)19-11)9-5-4-8(15)6-10(9)16/h4-6H,7H2,1-3H3 |
| InChIKey | ADZHPLGIUTZFIS-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 43.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.27 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |