C15H15Cl2FN4O — CID 86634065
1-N-(2,5-dichloropyrimidin-4-yl)-2-fluoro-4-N,4-N-dimethyl-6-prop-2-enoxybenzene-1,4-diamine (PubChem CID 86634065) has the molecular formula C15H15Cl2FN4O and a molecular weight of 357.22 g/mol. Its IUPAC name is 1-N-(2,5-dichloropyrimidin-4-yl)-2-fluoro-4-N,4-N-dimethyl-6-prop-2-enoxybenzene-1,4-diamine.
| Compound Name | 1-N-(2,5-dichloropyrimidin-4-yl)-2-fluoro-4-N,4-N-dimethyl-6-prop-2-enoxybenzene-1,4-diamine |
|---|---|
| PubChem CID | 86634065 |
| Molecular Formula | C15H15Cl2FN4O |
| Molecular Weight | 357.22 g/mol |
| Exact Mass | 356.06 |
| IUPAC Name | 1-N-(2,5-dichloropyrimidin-4-yl)-2-fluoro-4-N,4-N-dimethyl-6-prop-2-enoxybenzene-1,4-diamine |
| SMILES | C=CCOc1cc(N(C)C)cc(F)c1Nc1nc(Cl)ncc1Cl |
| InChI | InChI=1S/C15H15Cl2FN4O/c1-4-5-23-12-7-9(22(2)3)6-11(18)13(12)20-14-10(16)8-19-15(17)21-14/h4,6-8H,1,5H2,2-3H3,(H,19,20,21) |
| InChIKey | MSAQFJXFYORTGY-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.22 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|