C10H19FN2O3 — CID 86634504
tert-butyl N-[3-(2-fluoroethylamino)-3-oxopropyl]carbamate (PubChem CID 86634504) has the molecular formula C10H19FN2O3 and a molecular weight of 234.27 g/mol. Its IUPAC name is tert-butyl N-[3-(2-fluoroethylamino)-3-oxopropyl]carbamate.
| Compound Name | tert-butyl N-[3-(2-fluoroethylamino)-3-oxopropyl]carbamate |
|---|---|
| PubChem CID | 86634504 |
| Molecular Formula | C10H19FN2O3 |
| Molecular Weight | 234.27 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | tert-butyl N-[3-(2-fluoroethylamino)-3-oxopropyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC(=O)NCCF |
| InChI | InChI=1S/C10H19FN2O3/c1-10(2,3)16-9(15)13-6-4-8(14)12-7-5-11/h4-7H2,1-3H3,(H,12,14)(H,13,15) |
| InChIKey | GWBZCWFBNVXRKO-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.27 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |